C7H6F8 — CID 54114051
1,3,3,4,4-pentafluoro-2-(trifluoromethyl)hex-1-ene (PubChem CID 54114051) has the molecular formula C7H6F8 and a molecular weight of 242.11 g/mol. Its IUPAC name is 1,3,3,4,4-pentafluoro-2-(trifluoromethyl)hex-1-ene.
| Compound Name | 1,3,3,4,4-pentafluoro-2-(trifluoromethyl)hex-1-ene |
|---|---|
| PubChem CID | 54114051 |
| Molecular Formula | C7H6F8 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1,3,3,4,4-pentafluoro-2-(trifluoromethyl)hex-1-ene |
| SMILES | CCC(F)(F)C(F)(F)C(=CF)C(F)(F)F |
| InChI | InChI=1S/C7H6F8/c1-2-5(9,10)6(11,12)4(3-8)7(13,14)15/h3H,2H2,1H3 |
| InChIKey | NJCGGBUISDIVKT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|