C8H13F5O — CID 87318533
2-ethyl-3,3-difluoro-2-(trifluoromethyl)pentan-1-ol (PubChem CID 87318533) has the molecular formula C8H13F5O and a molecular weight of 220.18 g/mol. Its IUPAC name is 2-ethyl-3,3-difluoro-2-(trifluoromethyl)pentan-1-ol.
| Compound Name | 2-ethyl-3,3-difluoro-2-(trifluoromethyl)pentan-1-ol |
|---|---|
| PubChem CID | 87318533 |
| Molecular Formula | C8H13F5O |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-ethyl-3,3-difluoro-2-(trifluoromethyl)pentan-1-ol |
| SMILES | CCC(F)(F)C(CC)(CO)C(F)(F)F |
| InChI | InChI=1S/C8H13F5O/c1-3-6(5-14,8(11,12)13)7(9,10)4-2/h14H,3-5H2,1-2H3 |
| InChIKey | DLQDVPHJBVIOCT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |