C29H43N5O6 — CID 54117622
11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[2-(3,4,5-trimethoxyphenyl)ethyl]undecanamide (PubChem CID 54117622) has the molecular formula C29H43N5O6 and a molecular weight of 557.69 g/mol. Its IUPAC name is 11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[2-(3,4,5-trimethoxyphenyl)ethyl]undecanamide.
| Compound Name | 11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[2-(3,4,5-trimethoxyphenyl)ethyl]undecanamide |
|---|---|
| PubChem CID | 54117622 |
| Molecular Formula | C29H43N5O6 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.32 |
| IUPAC Name | 11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[2-(3,4,5-trimethoxyphenyl)ethyl]undecanamide |
| SMILES | COc1cc(CCNC(=O)CCCCCCCCCCn2c(=O)c3c(ncn3C)n(C)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C29H43N5O6/c1-32-20-31-27-25(32)28(36)34(29(37)33(27)2)17-13-11-9-7-6-8-10-12-14-24(35)30-16-15-21-18-22(38-3)26(40-5)23(19-21)39-4/h18-20H,6-17H2,1-5H3,(H,30,35) |
| InChIKey | NLLHRCMKXUAPDZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|