C16H16O8 — CID 54120703
bis(hydroxymethoxymethyl) naphthalene-2,6-dicarboxylate (PubChem CID 54120703) has the molecular formula C16H16O8 and a molecular weight of 336.30 g/mol. Its IUPAC name is bis(hydroxymethoxymethyl) naphthalene-2,6-dicarboxylate.
| Compound Name | bis(hydroxymethoxymethyl) naphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 54120703 |
| Molecular Formula | C16H16O8 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | bis(hydroxymethoxymethyl) naphthalene-2,6-dicarboxylate |
| SMILES | O=C(OCOCO)c1ccc2cc(C(=O)OCOCO)ccc2c1 |
| InChI | InChI=1S/C16H16O8/c17-7-21-9-23-15(19)13-3-1-11-5-14(4-2-12(11)6-13)16(20)24-10-22-8-18/h1-6,17-18H,7-10H2 |
| InChIKey | NNMJIJYNXMWZQK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|