C19H14O12 — CID 59700461
4-[(3,4-dicarboxyphenoxy)methoxymethoxycarbonyl]phthalic acid (PubChem CID 59700461) has the molecular formula C19H14O12 and a molecular weight of 434.31 g/mol. Its IUPAC name is 4-[(3,4-dicarboxyphenoxy)methoxymethoxycarbonyl]phthalic acid.
| Compound Name | 4-[(3,4-dicarboxyphenoxy)methoxymethoxycarbonyl]phthalic acid |
|---|---|
| PubChem CID | 59700461 |
| Molecular Formula | C19H14O12 |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 4-[(3,4-dicarboxyphenoxy)methoxymethoxycarbonyl]phthalic acid |
| SMILES | O=C(OCOCOc1ccc(C(=O)O)c(C(=O)O)c1)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H14O12/c20-15(21)11-3-1-9(5-13(11)17(24)25)19(28)31-8-29-7-30-10-2-4-12(16(22)23)14(6-10)18(26)27/h1-6H,7-8H2,(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | YRYVRIJQADUHAO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 193.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|