About 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine
3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine (PubChem CID 54127430) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine |
| PubChem CID | 54127430 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine |
| SMILES | NCCCC1(CCCN)OCCO1 |
| InChI | InChI=1S/C9H20N2O2/c10-5-1-3-9(4-2-6-11)12-7-8-13-9/h1-8,10-11H2 |
| InChIKey | NRYUUJAVVRZRGN-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine?
The IUPAC name of 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine (CID 54127430) is 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine.
What is the SMILES notation for 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine?
The canonical SMILES for 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine is NCCCC1(CCCN)OCCO1.
What is the InChIKey of 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine?
The InChIKey is NRYUUJAVVRZRGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c10-5-1-3-9(4-2-6-11)12-7-8-13-9/h1-8,10-11H2.
What are the key properties of 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine?
3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine has a molecular weight of 188.27 g/mol, XLogP of 0.21, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-aminopropyl)-1,3-dioxolan-2-yl]propan-1-amine is sourced from PubChem (CID 54127430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).