C29H32ClFN6O5 — CID 54127862
4-chloro-N-(3-fluoro-5-morpholin-4-ylphenyl)-3-[[5-[methyl-[3-(methylamino)propyl]amino]-2-nitrobenzoyl]amino]benzamide (PubChem CID 54127862) has the molecular formula C29H32ClFN6O5 and a molecular weight of 599.06 g/mol. Its IUPAC name is 4-chloro-N-(3-fluoro-5-morpholin-4-ylphenyl)-3-[[5-[methyl-[3-(methylamino)propyl]amino]-2-nitrobenzoyl]amino]benzamide.
| Compound Name | 4-chloro-N-(3-fluoro-5-morpholin-4-ylphenyl)-3-[[5-[methyl-[3-(methylamino)propyl]amino]-2-nitrobenzoyl]amino]benzamide |
|---|---|
| PubChem CID | 54127862 |
| Molecular Formula | C29H32ClFN6O5 |
| Molecular Weight | 599.06 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 4-chloro-N-(3-fluoro-5-morpholin-4-ylphenyl)-3-[[5-[methyl-[3-(methylamino)propyl]amino]-2-nitrobenzoyl]amino]benzamide |
| SMILES | CNCCCN(C)c1ccc([N+](=O)[O-])c(C(=O)Nc2cc(C(=O)Nc3cc(F)cc(N4CCOCC4)c3)ccc2Cl)c1 |
| InChI | InChI=1S/C29H32ClFN6O5/c1-32-8-3-9-35(2)22-5-7-27(37(40)41)24(18-22)29(39)34-26-14-19(4-6-25(26)30)28(38)33-21-15-20(31)16-23(17-21)36-10-12-42-13-11-36/h4-7,14-18,32H,3,8-13H2,1-2H3,(H,33,38)(H,34,39) |
| InChIKey | NSFYSGJVHHMPQR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.06 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|