C29H34ClFN6O4 — CID 70199393
4-chloro-3-[3-[3-(dimethylamino)propyl-methylamino]-2-nitroanilino]-N-(3-fluoro-5-morpholin-4-ylphenyl)benzamide (PubChem CID 70199393) has the molecular formula C29H34ClFN6O4 and a molecular weight of 585.08 g/mol. Its IUPAC name is 4-chloro-3-[3-[3-(dimethylamino)propyl-methylamino]-2-nitroanilino]-N-(3-fluoro-5-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-chloro-3-[3-[3-(dimethylamino)propyl-methylamino]-2-nitroanilino]-N-(3-fluoro-5-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 70199393 |
| Molecular Formula | C29H34ClFN6O4 |
| Molecular Weight | 585.08 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | 4-chloro-3-[3-[3-(dimethylamino)propyl-methylamino]-2-nitroanilino]-N-(3-fluoro-5-morpholin-4-ylphenyl)benzamide |
| SMILES | CN(C)CCCN(C)c1cccc(Nc2cc(C(=O)Nc3cc(F)cc(N4CCOCC4)c3)ccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C29H34ClFN6O4/c1-34(2)10-5-11-35(3)27-7-4-6-25(28(27)37(39)40)33-26-16-20(8-9-24(26)30)29(38)32-22-17-21(31)18-23(19-22)36-12-14-41-15-13-36/h4,6-9,16-19,33H,5,10-15H2,1-3H3,(H,32,38) |
| InChIKey | JVXKSRVXISEVKQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.08 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|