C14H20N2O7 — CID 54128494
2-[carboxymethyl-[(1R,2R)-2-(2,6-dioxomorpholin-4-yl)cyclohexyl]amino]acetic acid (PubChem CID 54128494) has the molecular formula C14H20N2O7 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-[carboxymethyl-[(1R,2R)-2-(2,6-dioxomorpholin-4-yl)cyclohexyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(1R,2R)-2-(2,6-dioxomorpholin-4-yl)cyclohexyl]amino]acetic acid |
|---|---|
| PubChem CID | 54128494 |
| Molecular Formula | C14H20N2O7 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[carboxymethyl-[(1R,2R)-2-(2,6-dioxomorpholin-4-yl)cyclohexyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)[C@@H]1CCCC[C@H]1N1CC(=O)OC(=O)C1 |
| InChI | InChI=1S/C14H20N2O7/c17-11(18)5-15(6-12(19)20)9-3-1-2-4-10(9)16-7-13(21)23-14(22)8-16/h9-10H,1-8H2,(H,17,18)(H,19,20)/t9-,10-/m1/s1 |
| InChIKey | NSQGXKOADTYGJA-NXEZZACHSA-N |
| XLogP | -0.85 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|