C15H19ClFN3O4S — CID 54129218
[(3R,4R)-4-(2-chloro-4-fluorophenyl)-4-hydroxy-3-methyl-5-(1,2,4-triazol-1-yl)pentan-2-yl] methanesulfonate (PubChem CID 54129218) has the molecular formula C15H19ClFN3O4S and a molecular weight of 391.85 g/mol. Its IUPAC name is [(3R,4R)-4-(2-chloro-4-fluorophenyl)-4-hydroxy-3-methyl-5-(1,2,4-triazol-1-yl)pentan-2-yl] methanesulfonate.
| Compound Name | [(3R,4R)-4-(2-chloro-4-fluorophenyl)-4-hydroxy-3-methyl-5-(1,2,4-triazol-1-yl)pentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 54129218 |
| Molecular Formula | C15H19ClFN3O4S |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | [(3R,4R)-4-(2-chloro-4-fluorophenyl)-4-hydroxy-3-methyl-5-(1,2,4-triazol-1-yl)pentan-2-yl] methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)[C@@H](C)[C@](O)(Cn1cncn1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H19ClFN3O4S/c1-10(11(2)24-25(3,22)23)15(21,7-20-9-18-8-19-20)13-5-4-12(17)6-14(13)16/h4-6,8-11,21H,7H2,1-3H3/t10-,11?,15-/m1/s1 |
| InChIKey | NTDPQMZPIDOOGO-MKOUYDOKSA-N |
| XLogP | 1.96 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|