C15H19F2N3O4S — CID 57115825
[(2S,3S,4R)-4-(2,6-difluorophenyl)-4-hydroxy-3-methyl-5-(1,2,4-triazol-1-yl)pentan-2-yl] methanesulfonate (PubChem CID 57115825) has the molecular formula C15H19F2N3O4S and a molecular weight of 375.40 g/mol. Its IUPAC name is [(2S,3S,4R)-4-(2,6-difluorophenyl)-4-hydroxy-3-methyl-5-(1,2,4-triazol-1-yl)pentan-2-yl] methanesulfonate.
| Compound Name | [(2S,3S,4R)-4-(2,6-difluorophenyl)-4-hydroxy-3-methyl-5-(1,2,4-triazol-1-yl)pentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 57115825 |
| Molecular Formula | C15H19F2N3O4S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [(2S,3S,4R)-4-(2,6-difluorophenyl)-4-hydroxy-3-methyl-5-(1,2,4-triazol-1-yl)pentan-2-yl] methanesulfonate |
| SMILES | C[C@H](OS(C)(=O)=O)[C@H](C)[C@](O)(Cn1cncn1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H19F2N3O4S/c1-10(11(2)24-25(3,22)23)15(21,7-20-9-18-8-19-20)14-12(16)5-4-6-13(14)17/h4-6,8-11,21H,7H2,1-3H3/t10-,11-,15+/m0/s1 |
| InChIKey | ITKYBTQBBURZSJ-ZIBATOQPSA-N |
| XLogP | 1.44 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|