C26H25ClO2S — CID 54133754
1-(3-phenylsulfanylphenyl)prop-2-enyl 2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 54133754) has the molecular formula C26H25ClO2S and a molecular weight of 437.00 g/mol. Its IUPAC name is 1-(3-phenylsulfanylphenyl)prop-2-enyl 2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | 1-(3-phenylsulfanylphenyl)prop-2-enyl 2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 54133754 |
| Molecular Formula | C26H25ClO2S |
| Molecular Weight | 437.00 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 1-(3-phenylsulfanylphenyl)prop-2-enyl 2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | C=CC(OC(=O)C(c1ccc(Cl)cc1)C(C)C)c1cccc(Sc2ccccc2)c1 |
| InChI | InChI=1S/C26H25ClO2S/c1-4-24(20-9-8-12-23(17-20)30-22-10-6-5-7-11-22)29-26(28)25(18(2)3)19-13-15-21(27)16-14-19/h4-18,24-25H,1H2,2-3H3 |
| InChIKey | NWEMXRQMRDZMLY-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.00 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|