C27H31N3O2 — CID 54139717
2-methyl-5-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[6H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-diol (PubChem CID 54139717) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-methyl-5-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[6H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-diol.
| Compound Name | 2-methyl-5-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[6H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-diol |
|---|---|
| PubChem CID | 54139717 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-methyl-5-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[6H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-diol |
| SMILES | Cn1c(O)c2c(c1O)C1(CCN([C@@H]3CCCc4ccccc43)CC1)N(c1ccccc1)C2 |
| InChI | InChI=1S/C27H31N3O2/c1-28-25(31)22-18-30(20-10-3-2-4-11-20)27(24(22)26(28)32)14-16-29(17-15-27)23-13-7-9-19-8-5-6-12-21(19)23/h2-6,8,10-12,23,31-32H,7,9,13-18H2,1H3/t23-/m1/s1 |
| InChIKey | OAFUAVATRPMRLV-HSZRJFAPSA-N |
| XLogP | 4.83 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |