C21H29N5O2 — CID 54140969
6-(methylamino)-N-[1-methyl-5-[2-[4-(methyldiazenyl)phenyl]acetyl]pyrrol-3-yl]hexanamide (PubChem CID 54140969) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 6-(methylamino)-N-[1-methyl-5-[2-[4-(methyldiazenyl)phenyl]acetyl]pyrrol-3-yl]hexanamide.
| Compound Name | 6-(methylamino)-N-[1-methyl-5-[2-[4-(methyldiazenyl)phenyl]acetyl]pyrrol-3-yl]hexanamide |
|---|---|
| PubChem CID | 54140969 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 6-(methylamino)-N-[1-methyl-5-[2-[4-(methyldiazenyl)phenyl]acetyl]pyrrol-3-yl]hexanamide |
| SMILES | C/N=N/c1ccc(CC(=O)c2cc(NC(=O)CCCCCNC)cn2C)cc1 |
| InChI | InChI=1S/C21H29N5O2/c1-22-12-6-4-5-7-21(28)24-18-14-19(26(3)15-18)20(27)13-16-8-10-17(11-9-16)25-23-2/h8-11,14-15,22H,4-7,12-13H2,1-3H3,(H,24,28)/b25-23+ |
| InChIKey | JYPOCBGXUPBKGJ-WJTDDFOZSA-N |
| XLogP | 3.88 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|