C21H36O — CID 54143464
4-(2,5-dimethylphenyl)-5-methyldodecan-5-ol (PubChem CID 54143464) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-5-methyldodecan-5-ol.
| Compound Name | 4-(2,5-dimethylphenyl)-5-methyldodecan-5-ol |
|---|---|
| PubChem CID | 54143464 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-5-methyldodecan-5-ol |
| SMILES | CCCCCCCC(C)(O)C(CCC)c1cc(C)ccc1C |
| InChI | InChI=1S/C21H36O/c1-6-8-9-10-11-15-21(5,22)20(12-7-2)19-16-17(3)13-14-18(19)4/h13-14,16,20,22H,6-12,15H2,1-5H3 |
| InChIKey | GFAMQNLMYYEWHY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|