C31H43NSi — CID 54148514
4-[4-[2-[1-[4-(3-methylbutyl)cyclohexyl]silinan-4-yl]ethyl]phenyl]benzonitrile (PubChem CID 54148514) has the molecular formula C31H43NSi and a molecular weight of 457.78 g/mol. Its IUPAC name is 4-[4-[2-[1-[4-(3-methylbutyl)cyclohexyl]silinan-4-yl]ethyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[2-[1-[4-(3-methylbutyl)cyclohexyl]silinan-4-yl]ethyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 54148514 |
| Molecular Formula | C31H43NSi |
| Molecular Weight | 457.78 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | 4-[4-[2-[1-[4-(3-methylbutyl)cyclohexyl]silinan-4-yl]ethyl]phenyl]benzonitrile |
| SMILES | CC(C)CCC1CCC([SiH]2CCC(CCc3ccc(-c4ccc(C#N)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C31H43NSi/c1-24(2)3-4-25-11-17-31(18-12-25)33-21-19-27(20-22-33)6-5-26-7-13-29(14-8-26)30-15-9-28(23-32)10-16-30/h7-10,13-16,24-25,27,31,33H,3-6,11-12,17-22H2,1-2H3 |
| InChIKey | OGBKGQCMAGCOAJ-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.78 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|