C10H8F2N4O — CID 5415389
(Z)-1-[4-(difluoromethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 5415389) has the molecular formula C10H8F2N4O and a molecular weight of 238.20 g/mol. Its IUPAC name is (Z)-1-[4-(difluoromethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-[4-(difluoromethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5415389 |
| Molecular Formula | C10H8F2N4O |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (Z)-1-[4-(difluoromethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | FC(F)Oc1ccc(/C=N\n2cnnc2)cc1 |
| InChI | InChI=1S/C10H8F2N4O/c11-10(12)17-9-3-1-8(2-4-9)5-15-16-6-13-14-7-16/h1-7,10H/b15-5- |
| InChIKey | MJCSGYFPHIQCIN-WCSRMQSCSA-N |
| XLogP | 1.76 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|