C9H7BrN4 — CID 690735
1-(4-bromophenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 690735) has the molecular formula C9H7BrN4 and a molecular weight of 251.09 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-(4-bromophenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 690735 |
| Molecular Formula | C9H7BrN4 |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 1-(4-bromophenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Brc1ccc(C=Nn2cnnc2)cc1 |
| InChI | InChI=1S/C9H7BrN4/c10-9-3-1-8(2-4-9)5-13-14-6-11-12-7-14/h1-7H |
| InChIKey | DNEVVDSOWJXLAW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|