C24H18Br2N6 — CID 98049208
(Z)-1-[4-[(3R)-3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]phenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 98049208) has the molecular formula C24H18Br2N6 and a molecular weight of 550.26 g/mol. Its IUPAC name is (Z)-1-[4-[(3R)-3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]phenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-[4-[(3R)-3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 98049208 |
| Molecular Formula | C24H18Br2N6 |
| Molecular Weight | 550.26 g/mol |
| Exact Mass | 548.00 |
| IUPAC Name | (Z)-1-[4-[(3R)-3,5-bis(4-bromophenyl)-3,4-dihydropyrazol-2-yl]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Brc1ccc(C2=NN(c3ccc(/C=N\n4cnnc4)cc3)[C@@H](c3ccc(Br)cc3)C2)cc1 |
| InChI | InChI=1S/C24H18Br2N6/c25-20-7-3-18(4-8-20)23-13-24(19-5-9-21(26)10-6-19)32(30-23)22-11-1-17(2-12-22)14-29-31-15-27-28-16-31/h1-12,14-16,24H,13H2/b29-14-/t24-/m1/s1 |
| InChIKey | WIATUOPGEFVMTJ-NMBZELBNSA-N |
| XLogP | 6.04 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.26 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|