C14H12Cl2O4S2 — CID 54154214
4-(3,5-dichloro-4-methylphenyl)-2-ethoxycarbothioylsulfanyl-4-oxobut-2-enoic acid (PubChem CID 54154214) has the molecular formula C14H12Cl2O4S2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 4-(3,5-dichloro-4-methylphenyl)-2-ethoxycarbothioylsulfanyl-4-oxobut-2-enoic acid.
| Compound Name | 4-(3,5-dichloro-4-methylphenyl)-2-ethoxycarbothioylsulfanyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54154214 |
| Molecular Formula | C14H12Cl2O4S2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 4-(3,5-dichloro-4-methylphenyl)-2-ethoxycarbothioylsulfanyl-4-oxobut-2-enoic acid |
| SMILES | CCOC(=S)SC(=CC(=O)c1cc(Cl)c(C)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C14H12Cl2O4S2/c1-3-20-14(21)22-12(13(18)19)6-11(17)8-4-9(15)7(2)10(16)5-8/h4-6H,3H2,1-2H3,(H,18,19) |
| InChIKey | OJWQSGNJNDQEQF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|