C6H9N5O2 — CID 54158022
2-(hydroxyamino)-2,3,4a,7-tetrahydro-1H-pteridin-4-one (PubChem CID 54158022) has the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-(hydroxyamino)-2,3,4a,7-tetrahydro-1H-pteridin-4-one.
| Compound Name | 2-(hydroxyamino)-2,3,4a,7-tetrahydro-1H-pteridin-4-one |
|---|---|
| PubChem CID | 54158022 |
| Molecular Formula | C6H9N5O2 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-(hydroxyamino)-2,3,4a,7-tetrahydro-1H-pteridin-4-one |
| SMILES | O=C1NC(NO)NC2=NCC=NC12 |
| InChI | InChI=1S/C6H9N5O2/c12-5-3-4(8-2-1-7-3)9-6(10-5)11-13/h1,3,6,11,13H,2H2,(H,8,9)(H,10,12) |
| InChIKey | OMLDCWBYDGCBHL-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|