C8H12N6O — CID 91486221
2-amino-6-(2-iminoethyl)-2,3,4a,7-tetrahydro-1H-pteridin-4-one (PubChem CID 91486221) has the molecular formula C8H12N6O and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-amino-6-(2-iminoethyl)-2,3,4a,7-tetrahydro-1H-pteridin-4-one.
| Compound Name | 2-amino-6-(2-iminoethyl)-2,3,4a,7-tetrahydro-1H-pteridin-4-one |
|---|---|
| PubChem CID | 91486221 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-amino-6-(2-iminoethyl)-2,3,4a,7-tetrahydro-1H-pteridin-4-one |
| SMILES | [H]/N=C/CC1=NC2C(=O)NC(N)NC2=NC1 |
| InChI | InChI=1S/C8H12N6O/c9-2-1-4-3-11-6-5(12-4)7(15)14-8(10)13-6/h2,5,8-9H,1,3,10H2,(H,11,13)(H,14,15)/b9-2+ |
| InChIKey | AEJJUPCWDJHUJK-XNWCZRBMSA-N |
| XLogP | -1.79 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|