C19H18F3N3OS — CID 54161012
4-[2-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanylmethyl]phenyl]morpholine (PubChem CID 54161012) has the molecular formula C19H18F3N3OS and a molecular weight of 393.43 g/mol. Its IUPAC name is 4-[2-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanylmethyl]phenyl]morpholine.
| Compound Name | 4-[2-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanylmethyl]phenyl]morpholine |
|---|---|
| PubChem CID | 54161012 |
| Molecular Formula | C19H18F3N3OS |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 4-[2-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanylmethyl]phenyl]morpholine |
| SMILES | FC(F)(F)c1ccc2nc(SCc3ccccc3N3CCOCC3)[nH]c2c1 |
| InChI | InChI=1S/C19H18F3N3OS/c20-19(21,22)14-5-6-15-16(11-14)24-18(23-15)27-12-13-3-1-2-4-17(13)25-7-9-26-10-8-25/h1-6,11H,7-10,12H2,(H,23,24) |
| InChIKey | OOKCLRGKGWEOAI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |