C23H25O4P — CID 54167353
3-[hydroxy(2-naphthalen-1-ylethyl)phosphoryl]-2-phenylpentanoic acid (PubChem CID 54167353) has the molecular formula C23H25O4P and a molecular weight of 396.42 g/mol. Its IUPAC name is 3-[hydroxy(2-naphthalen-1-ylethyl)phosphoryl]-2-phenylpentanoic acid.
| Compound Name | 3-[hydroxy(2-naphthalen-1-ylethyl)phosphoryl]-2-phenylpentanoic acid |
|---|---|
| PubChem CID | 54167353 |
| Molecular Formula | C23H25O4P |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-[hydroxy(2-naphthalen-1-ylethyl)phosphoryl]-2-phenylpentanoic acid |
| SMILES | CCC(C(C(=O)O)c1ccccc1)P(=O)(O)CCc1cccc2ccccc12 |
| InChI | InChI=1S/C23H25O4P/c1-2-21(22(23(24)25)19-10-4-3-5-11-19)28(26,27)16-15-18-13-8-12-17-9-6-7-14-20(17)18/h3-14,21-22H,2,15-16H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | OSOYMAWOBRLLLT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|