C19H20NO4P — CID 19357743
3-[hydroxy(1H-indol-4-yl)phosphoryl]-2-phenylpentanoic acid (PubChem CID 19357743) has the molecular formula C19H20NO4P and a molecular weight of 357.35 g/mol. Its IUPAC name is 3-[hydroxy(1H-indol-4-yl)phosphoryl]-2-phenylpentanoic acid.
| Compound Name | 3-[hydroxy(1H-indol-4-yl)phosphoryl]-2-phenylpentanoic acid |
|---|---|
| PubChem CID | 19357743 |
| Molecular Formula | C19H20NO4P |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3-[hydroxy(1H-indol-4-yl)phosphoryl]-2-phenylpentanoic acid |
| SMILES | CCC(C(C(=O)O)c1ccccc1)P(=O)(O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C19H20NO4P/c1-2-16(18(19(21)22)13-7-4-3-5-8-13)25(23,24)17-10-6-9-15-14(17)11-12-20-15/h3-12,16,18,20H,2H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | DFMCRTXAIZJXDI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|