C10H11F3N2O3S — CID 54168288
4-(dimethylsulfamoyl)-2-(trifluoromethyl)benzamide (PubChem CID 54168288) has the molecular formula C10H11F3N2O3S and a molecular weight of 296.27 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 54168288 |
| Molecular Formula | C10H11F3N2O3S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 4-(dimethylsulfamoyl)-2-(trifluoromethyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(N)=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2O3S/c1-15(2)19(17,18)6-3-4-7(9(14)16)8(5-6)10(11,12)13/h3-5H,1-2H3,(H2,14,16) |
| InChIKey | OTFFIBGHSIEZDG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |