C6H18N4 — CID 54172083
hexane-1,2,3,6-tetramine (PubChem CID 54172083) has the molecular formula C6H18N4 and a molecular weight of 146.24 g/mol. Its IUPAC name is hexane-1,2,3,6-tetramine.
| Compound Name | hexane-1,2,3,6-tetramine |
|---|---|
| PubChem CID | 54172083 |
| Molecular Formula | C6H18N4 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.15 |
| IUPAC Name | hexane-1,2,3,6-tetramine |
| SMILES | NCCCC(N)C(N)CN |
| InChI | InChI=1S/C6H18N4/c7-3-1-2-5(9)6(10)4-8/h5-6H,1-4,7-10H2 |
| InChIKey | OVSITQVSSAFMTB-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |