C5H10I2N2O2 — CID 54175618
[(4R,5R)-5-(aminomethyl)-2,2-diiodo-1,3-dioxolan-4-yl]methanamine (PubChem CID 54175618) has the molecular formula C5H10I2N2O2 and a molecular weight of 383.96 g/mol. Its IUPAC name is [(4R,5R)-5-(aminomethyl)-2,2-diiodo-1,3-dioxolan-4-yl]methanamine.
| Compound Name | [(4R,5R)-5-(aminomethyl)-2,2-diiodo-1,3-dioxolan-4-yl]methanamine |
|---|---|
| PubChem CID | 54175618 |
| Molecular Formula | C5H10I2N2O2 |
| Molecular Weight | 383.96 g/mol |
| Exact Mass | 383.88 |
| IUPAC Name | [(4R,5R)-5-(aminomethyl)-2,2-diiodo-1,3-dioxolan-4-yl]methanamine |
| SMILES | NC[C@H]1OC(I)(I)O[C@@H]1CN |
| InChI | InChI=1S/C5H10I2N2O2/c6-5(7)10-3(1-8)4(2-9)11-5/h3-4H,1-2,8-9H2/t3-,4-/m1/s1 |
| InChIKey | OYDBAYDGKHKUFW-QWWZWVQMSA-N |
| XLogP | 0.17 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.96 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|