C20H27NO3 — CID 54175692
2-[[(1S,9R,10R)-4-methoxy-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]methyl]cyclopropan-1-ol (PubChem CID 54175692) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-[[(1S,9R,10R)-4-methoxy-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]methyl]cyclopropan-1-ol.
| Compound Name | 2-[[(1S,9R,10R)-4-methoxy-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]methyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 54175692 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-[[(1S,9R,10R)-4-methoxy-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]methyl]cyclopropan-1-ol |
| SMILES | COc1ccc2c(c1)[C@]13CCN(CC4CC4O)[C@H](C2)[C@@H]1CCOC3 |
| InChI | InChI=1S/C20H27NO3/c1-23-15-3-2-13-8-18-16-4-7-24-12-20(16,17(13)10-15)5-6-21(18)11-14-9-19(14)22/h2-3,10,14,16,18-19,22H,4-9,11-12H2,1H3/t14?,16-,18+,19?,20-/m0/s1 |
| InChIKey | OYELBVVQRQIKJK-HSCGEBJWSA-N |
| XLogP | 1.98 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |