C21H27NO4 — CID 54362154
[(1S,9R,10R)-17-[(2-hydroxycyclopropyl)methyl]-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] acetate (PubChem CID 54362154) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is [(1S,9R,10R)-17-[(2-hydroxycyclopropyl)methyl]-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] acetate.
| Compound Name | [(1S,9R,10R)-17-[(2-hydroxycyclopropyl)methyl]-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] acetate |
|---|---|
| PubChem CID | 54362154 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [(1S,9R,10R)-17-[(2-hydroxycyclopropyl)methyl]-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)[C@]13CCN(CC4CC4O)[C@H](C2)[C@@H]1CCOC3 |
| InChI | InChI=1S/C21H27NO4/c1-13(23)26-16-3-2-14-8-19-17-4-7-25-12-21(17,18(14)10-16)5-6-22(19)11-15-9-20(15)24/h2-3,10,15,17,19-20,24H,4-9,11-12H2,1H3/t15?,17-,19+,20?,21-/m0/s1 |
| InChIKey | UNFZUUYVXOAOOK-VCLIMAMBSA-N |
| XLogP | 1.90 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|