C36H61NO5 — CID 54176285
2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyl-(2-hydroxyethyl)amino]ethyl octadec-9-enoate (PubChem CID 54176285) has the molecular formula C36H61NO5 and a molecular weight of 587.89 g/mol. Its IUPAC name is 2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyl-(2-hydroxyethyl)amino]ethyl octadec-9-enoate.
| Compound Name | 2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyl-(2-hydroxyethyl)amino]ethyl octadec-9-enoate |
|---|---|
| PubChem CID | 54176285 |
| Molecular Formula | C36H61NO5 |
| Molecular Weight | 587.89 g/mol |
| Exact Mass | 587.45 |
| IUPAC Name | 2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyl-(2-hydroxyethyl)amino]ethyl octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCCN(CCO)C(=O)CCc1cc(C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H61NO5/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-34(40)42-27-25-37(24-26-38)33(39)23-22-31-28-30(2)35(41)32(29-31)36(3,4)5/h13-14,28-29,38,41H,6-12,15-27H2,1-5H3 |
| InChIKey | OYOYAZSFZWHJAP-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.89 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|