C13H21NOS2Si — CID 54179584
N-(4-methylphenyl)-2-(trimethylsilylmethylsulfinothioyl)acetamide (PubChem CID 54179584) has the molecular formula C13H21NOS2Si and a molecular weight of 299.54 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-(trimethylsilylmethylsulfinothioyl)acetamide.
| Compound Name | N-(4-methylphenyl)-2-(trimethylsilylmethylsulfinothioyl)acetamide |
|---|---|
| PubChem CID | 54179584 |
| Molecular Formula | C13H21NOS2Si |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-(4-methylphenyl)-2-(trimethylsilylmethylsulfinothioyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CS(=S)C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C13H21NOS2Si/c1-11-5-7-12(8-6-11)14-13(15)9-17(16)10-18(2,3)4/h5-8H,9-10H2,1-4H3,(H,14,15) |
| InChIKey | PAWDXKRLNMZFLP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|