C26H24O8 — CID 54180163
(4-methoxyphenyl)methyl 3-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxyphenyl]propanoate (PubChem CID 54180163) has the molecular formula C26H24O8 and a molecular weight of 464.47 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 3-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxyphenyl]propanoate.
| Compound Name | (4-methoxyphenyl)methyl 3-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxyphenyl]propanoate |
|---|---|
| PubChem CID | 54180163 |
| Molecular Formula | C26H24O8 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (4-methoxyphenyl)methyl 3-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxyphenyl]propanoate |
| SMILES | COc1ccc(COC(=O)CCc2ccc(OC(=O)C=Cc3ccc(O)c(O)c3)c(O)c2)cc1 |
| InChI | InChI=1S/C26H24O8/c1-32-20-8-2-19(3-9-20)16-33-25(30)12-6-18-5-11-24(23(29)15-18)34-26(31)13-7-17-4-10-21(27)22(28)14-17/h2-5,7-11,13-15,27-29H,6,12,16H2,1H3 |
| InChIKey | PBFQFOXWWURFBA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|