C17H17NO7 — CID 89151554
[4-[(dihydroxyamino)oxymethyl]phenyl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 89151554) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is [4-[(dihydroxyamino)oxymethyl]phenyl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(dihydroxyamino)oxymethyl]phenyl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 89151554 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [4-[(dihydroxyamino)oxymethyl]phenyl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2ccc(CON(O)O)cc2)cc1O |
| InChI | InChI=1S/C17H17NO7/c1-23-16-8-4-12(10-15(16)19)5-9-17(20)25-14-6-2-13(3-7-14)11-24-18(21)22/h2-10,19,21-22H,11H2,1H3/b9-5+ |
| InChIKey | RZELLIIJRQBJSQ-WEVVVXLNSA-N |
| XLogP | 2.53 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|