C11H10N2 — CID 54190879
3,10b-dihydroimidazo[2,1-a]isoquinoline (PubChem CID 54190879) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 3,10b-dihydroimidazo[2,1-a]isoquinoline.
| Compound Name | 3,10b-dihydroimidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 54190879 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 3,10b-dihydroimidazo[2,1-a]isoquinoline |
| SMILES | C1=CN2CC=NC2c2ccccc21 |
| InChI | InChI=1S/C11H10N2/c1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13/h1-7,11H,8H2 |
| InChIKey | PIKODQPKLYKYMT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |