C22H27N3O5 — CID 54194740
8-methoxy-5-[2-[methyl-[3-(4-nitrophenyl)propyl]amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 54194740) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 8-methoxy-5-[2-[methyl-[3-(4-nitrophenyl)propyl]amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 8-methoxy-5-[2-[methyl-[3-(4-nitrophenyl)propyl]amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54194740 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 8-methoxy-5-[2-[methyl-[3-(4-nitrophenyl)propyl]amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1ccc(OCCN(C)CCCc2ccc([N+](=O)[O-])cc2)c2c1NC(=O)CC2 |
| InChI | InChI=1S/C22H27N3O5/c1-24(13-3-4-16-5-7-17(8-6-16)25(27)28)14-15-30-19-10-11-20(29-2)22-18(19)9-12-21(26)23-22/h5-8,10-11H,3-4,9,12-15H2,1-2H3,(H,23,26) |
| InChIKey | PKZYWUVIPPIEAC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|