C18H22Cl3NO6 — CID 54202281
(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)-(2,2,2-trichloroethoxycarbonyl)amino]propanoic acid (PubChem CID 54202281) has the molecular formula C18H22Cl3NO6 and a molecular weight of 454.73 g/mol. Its IUPAC name is (2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)-(2,2,2-trichloroethoxycarbonyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)-(2,2,2-trichloroethoxycarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 54202281 |
| Molecular Formula | C18H22Cl3NO6 |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | (2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)-(2,2,2-trichloroethoxycarbonyl)amino]propanoic acid |
| SMILES | CCOC(=O)C(CCc1ccccc1)N(C(=O)OCC(Cl)(Cl)Cl)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C18H22Cl3NO6/c1-3-27-16(25)14(10-9-13-7-5-4-6-8-13)22(12(2)15(23)24)17(26)28-11-18(19,20)21/h4-8,12,14H,3,9-11H2,1-2H3,(H,23,24)/t12-,14?/m0/s1 |
| InChIKey | PQCCPHWZMNBDJK-NBFOIZRFSA-N |
| XLogP | 3.83 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|