C16H28O2 — CID 54204966
2,7,10,11-tetramethyldodeca-2,4-dienoic acid (PubChem CID 54204966) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2,7,10,11-tetramethyldodeca-2,4-dienoic acid.
| Compound Name | 2,7,10,11-tetramethyldodeca-2,4-dienoic acid |
|---|---|
| PubChem CID | 54204966 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2,7,10,11-tetramethyldodeca-2,4-dienoic acid |
| SMILES | CC(=CC=CCC(C)CCC(C)C(C)C)C(=O)O |
| InChI | InChI=1S/C16H28O2/c1-12(2)14(4)11-10-13(3)8-6-7-9-15(5)16(17)18/h6-7,9,12-14H,8,10-11H2,1-5H3,(H,17,18) |
| InChIKey | PRWLNRMUPBAGHF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|