C10H12O2 — CID 54204979
2-(6-hydroxy-2,3-dimethylphenyl)acetaldehyde (PubChem CID 54204979) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-(6-hydroxy-2,3-dimethylphenyl)acetaldehyde.
| Compound Name | 2-(6-hydroxy-2,3-dimethylphenyl)acetaldehyde |
|---|---|
| PubChem CID | 54204979 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-(6-hydroxy-2,3-dimethylphenyl)acetaldehyde |
| SMILES | Cc1ccc(O)c(CC=O)c1C |
| InChI | InChI=1S/C10H12O2/c1-7-3-4-10(12)9(5-6-11)8(7)2/h3-4,6,12H,5H2,1-2H3 |
| InChIKey | PRWPOFJLRRSEPO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|