C14H14O3 — CID 123744942
2-(1,8-dihydroxy-3,6-dimethylnaphthalen-2-yl)acetaldehyde (PubChem CID 123744942) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-(1,8-dihydroxy-3,6-dimethylnaphthalen-2-yl)acetaldehyde.
| Compound Name | 2-(1,8-dihydroxy-3,6-dimethylnaphthalen-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 123744942 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-(1,8-dihydroxy-3,6-dimethylnaphthalen-2-yl)acetaldehyde |
| SMILES | Cc1cc(O)c2c(O)c(CC=O)c(C)cc2c1 |
| InChI | InChI=1S/C14H14O3/c1-8-5-10-7-9(2)11(3-4-15)14(17)13(10)12(16)6-8/h4-7,16-17H,3H2,1-2H3 |
| InChIKey | UKPGKYSBRYTLFJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|