C15H12O5 — CID 71397460
7-methylanthracene-1,2,4,5,10-pentol (PubChem CID 71397460) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 7-methylanthracene-1,2,4,5,10-pentol.
| Compound Name | 7-methylanthracene-1,2,4,5,10-pentol |
|---|---|
| PubChem CID | 71397460 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 7-methylanthracene-1,2,4,5,10-pentol |
| SMILES | Cc1cc(O)c2c(O)c3c(O)cc(O)c(O)c3cc2c1 |
| InChI | InChI=1S/C15H12O5/c1-6-2-7-4-8-13(10(17)5-11(18)14(8)19)15(20)12(7)9(16)3-6/h2-5,16-20H,1H3 |
| InChIKey | HCIAUMUTROGRJX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|