C17H21IO3 — CID 123134198
1-iodo-2,3,4,5-tetramethylbenzene;5-methylbenzene-1,2,3-triol (PubChem CID 123134198) has the molecular formula C17H21IO3 and a molecular weight of 400.26 g/mol. Its IUPAC name is 1-iodo-2,3,4,5-tetramethylbenzene;5-methylbenzene-1,2,3-triol.
| Compound Name | 1-iodo-2,3,4,5-tetramethylbenzene;5-methylbenzene-1,2,3-triol |
|---|---|
| PubChem CID | 123134198 |
| Molecular Formula | C17H21IO3 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 1-iodo-2,3,4,5-tetramethylbenzene;5-methylbenzene-1,2,3-triol |
| SMILES | Cc1cc(I)c(C)c(C)c1C.Cc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C10H13I.C7H8O3/c1-6-5-10(11)9(4)8(3)7(6)2;1-4-2-5(8)7(10)6(9)3-4/h5H,1-4H3;2-3,8-10H,1H3 |
| InChIKey | JLQIMUYZXJKBKG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|