C10H11INOY- — CID 59954371
(6-iodo-2,3,4-trimethylbenzoyl)azanide;yttrium (PubChem CID 59954371) has the molecular formula C10H11INOY- and a molecular weight of 377.01 g/mol. Its IUPAC name is (6-iodo-2,3,4-trimethylbenzoyl)azanide;yttrium.
| Compound Name | (6-iodo-2,3,4-trimethylbenzoyl)azanide;yttrium |
|---|---|
| PubChem CID | 59954371 |
| Molecular Formula | C10H11INOY- |
| Molecular Weight | 377.01 g/mol |
| Exact Mass | 376.89 |
| IUPAC Name | (6-iodo-2,3,4-trimethylbenzoyl)azanide;yttrium |
| SMILES | Cc1cc(I)c(C([NH-])=O)c(C)c1C.[Y] |
| InChI | InChI=1S/C10H12INO.Y/c1-5-4-8(11)9(10(12)13)7(3)6(5)2;/h4H,1-3H3,(H2,12,13);/p-1 |
| InChIKey | CLDWSKBIKBHHAF-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.01 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|