C10H10IKO2 — CID 141158453
potassium 2-iodo-3,4,5-trimethylbenzoate (PubChem CID 141158453) has the molecular formula C10H10IKO2 and a molecular weight of 328.19 g/mol. Its IUPAC name is potassium 2-iodo-3,4,5-trimethylbenzoate.
| Compound Name | potassium 2-iodo-3,4,5-trimethylbenzoate |
|---|---|
| PubChem CID | 141158453 |
| Molecular Formula | C10H10IKO2 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | potassium 2-iodo-3,4,5-trimethylbenzoate |
| SMILES | Cc1cc(C(=O)[O-])c(I)c(C)c1C.[K+] |
| InChI | InChI=1S/C10H11IO2.K/c1-5-4-8(10(12)13)9(11)7(3)6(5)2;/h4H,1-3H3,(H,12,13);/q;+1/p-1 |
| InChIKey | OIWNLVVAYXUDAY-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|