C9H7CsN2O2S — CID 140605868
cesium 4,7-dimethyl-2,1,3-benzothiadiazole-5-carboxylate (PubChem CID 140605868) has the molecular formula C9H7CsN2O2S and a molecular weight of 340.14 g/mol. Its IUPAC name is cesium 4,7-dimethyl-2,1,3-benzothiadiazole-5-carboxylate.
| Compound Name | cesium 4,7-dimethyl-2,1,3-benzothiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 140605868 |
| Molecular Formula | C9H7CsN2O2S |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 339.93 |
| IUPAC Name | cesium 4,7-dimethyl-2,1,3-benzothiadiazole-5-carboxylate |
| SMILES | Cc1cc(C(=O)[O-])c(C)c2nsnc12.[Cs+] |
| InChI | InChI=1S/C9H8N2O2S.Cs/c1-4-3-6(9(12)13)5(2)8-7(4)10-14-11-8;/h3H,1-2H3,(H,12,13);/q;+1/p-1 |
| InChIKey | DNKKVOMNZNWYBC-UHFFFAOYSA-M |
| XLogP | -2.32 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |