C28H36O2 — CID 54205469
2,4,4-trimethyl-3-[10-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]cyclohex-2-en-1-one (PubChem CID 54205469) has the molecular formula C28H36O2 and a molecular weight of 404.59 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-[10-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]cyclohex-2-en-1-one.
| Compound Name | 2,4,4-trimethyl-3-[10-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 54205469 |
| Molecular Formula | C28H36O2 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 2,4,4-trimethyl-3-[10-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]cyclohex-2-en-1-one |
| SMILES | CC1=C(C=CC=CC=CC=CC=CC2=C(C)C(=O)CCC2(C)C)C(C)(C)CCC1=O |
| InChI | InChI=1S/C28H36O2/c1-21-23(27(3,4)19-17-25(21)29)15-13-11-9-7-8-10-12-14-16-24-22(2)26(30)18-20-28(24,5)6/h7-16H,17-20H2,1-6H3 |
| InChIKey | PSELIXCVDHUETL-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|