C17H32O5Si — CID 54211782
2-[butyl(dimethyl)silyl]oxy-5-(2,2,5-trimethyl-1,3-dioxolan-4-yl)pent-4-enoic acid (PubChem CID 54211782) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is 2-[butyl(dimethyl)silyl]oxy-5-(2,2,5-trimethyl-1,3-dioxolan-4-yl)pent-4-enoic acid.
| Compound Name | 2-[butyl(dimethyl)silyl]oxy-5-(2,2,5-trimethyl-1,3-dioxolan-4-yl)pent-4-enoic acid |
|---|---|
| PubChem CID | 54211782 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-[butyl(dimethyl)silyl]oxy-5-(2,2,5-trimethyl-1,3-dioxolan-4-yl)pent-4-enoic acid |
| SMILES | CCCC[Si](C)(C)OC(CC=CC1OC(C)(C)OC1C)C(=O)O |
| InChI | InChI=1S/C17H32O5Si/c1-7-8-12-23(5,6)22-15(16(18)19)11-9-10-14-13(2)20-17(3,4)21-14/h9-10,13-15H,7-8,11-12H2,1-6H3,(H,18,19) |
| InChIKey | PWLDKBQSJVMTQM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|