About 3-chloro-1-ethylpyrrole
3-chloro-1-ethylpyrrole (PubChem CID 54215329) has the molecular formula C6H8ClN
and a molecular weight of 129.59 g/mol. Its IUPAC name is 3-chloro-1-ethylpyrrole.
Molecular Properties
| Compound Name | 3-chloro-1-ethylpyrrole |
| PubChem CID | 54215329 |
| Molecular Formula | C6H8ClN |
| Molecular Weight | 129.59 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | 3-chloro-1-ethylpyrrole |
| SMILES | CCn1ccc(Cl)c1 |
| InChI | InChI=1S/C6H8ClN/c1-2-8-4-3-6(7)5-8/h3-5H,2H2,1H3 |
| InChIKey | SVEKAXKMGMLCGA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-1-ethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-ethylpyrrole?
The IUPAC name of 3-chloro-1-ethylpyrrole (CID 54215329) is 3-chloro-1-ethylpyrrole.
What is the SMILES notation for 3-chloro-1-ethylpyrrole?
The canonical SMILES for 3-chloro-1-ethylpyrrole is CCn1ccc(Cl)c1.
What is the InChIKey of 3-chloro-1-ethylpyrrole?
The InChIKey is SVEKAXKMGMLCGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClN/c1-2-8-4-3-6(7)5-8/h3-5H,2H2,1H3.
What are the key properties of 3-chloro-1-ethylpyrrole?
3-chloro-1-ethylpyrrole has a molecular weight of 129.59 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-ethylpyrrole is sourced from PubChem (CID 54215329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).