C14H20O — CID 54215997
2,4,4-trimethyl-3-(3-methyl-5-tritiopenta-1,3-dienyl)cyclopent-2-en-1-one (PubChem CID 54215997) has the molecular formula C14H20O and a molecular weight of 206.32 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-(3-methyl-5-tritiopenta-1,3-dienyl)cyclopent-2-en-1-one.
| Compound Name | 2,4,4-trimethyl-3-(3-methyl-5-tritiopenta-1,3-dienyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 54215997 |
| Molecular Formula | C14H20O |
| Molecular Weight | 206.32 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | 2,4,4-trimethyl-3-(3-methyl-5-tritiopenta-1,3-dienyl)cyclopent-2-en-1-one |
| SMILES | [3H]CC=C(C)C=CC1=C(C)C(=O)CC1(C)C |
| InChI | InChI=1S/C14H20O/c1-6-10(2)7-8-12-11(3)13(15)9-14(12,4)5/h6-8H,9H2,1-5H3/i1T |
| InChIKey | PZFGTOZGUHNARH-CNRUNOGKSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|