C21H18ClNO4 — CID 54217493
2-[1-(2-chlorobenzoyl)-5-methoxy-2-prop-2-enylindol-3-yl]acetic acid (PubChem CID 54217493) has the molecular formula C21H18ClNO4 and a molecular weight of 383.83 g/mol. Its IUPAC name is 2-[1-(2-chlorobenzoyl)-5-methoxy-2-prop-2-enylindol-3-yl]acetic acid.
| Compound Name | 2-[1-(2-chlorobenzoyl)-5-methoxy-2-prop-2-enylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 54217493 |
| Molecular Formula | C21H18ClNO4 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-[1-(2-chlorobenzoyl)-5-methoxy-2-prop-2-enylindol-3-yl]acetic acid |
| SMILES | C=CCc1c(CC(=O)O)c2cc(OC)ccc2n1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H18ClNO4/c1-3-6-18-16(12-20(24)25)15-11-13(27-2)9-10-19(15)23(18)21(26)14-7-4-5-8-17(14)22/h3-5,7-11H,1,6,12H2,2H3,(H,24,25) |
| InChIKey | QAFXBVIGXLNONC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|